C29H29FN4O11 — CID 168846843
[4-[[1-[2-(2-aminoethoxy)ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate (PubChem CID 168846843) has the molecular formula C29H29FN4O11 and a molecular weight of 628.57 g/mol. Its IUPAC name is [4-[[1-[2-(2-aminoethoxy)ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate.
| Compound Name | [4-[[1-[2-(2-aminoethoxy)ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate |
|---|---|
| PubChem CID | 168846843 |
| Molecular Formula | C29H29FN4O11 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | [4-[[1-[2-(2-aminoethoxy)ethyl]triazol-4-yl]methoxy]-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3-fluoro-4-hydroxybenzoate |
| SMILES | NCCOCCn1cc(COC2c3c(O)cc(O)cc3OC(c3cc(O)c(O)c(O)c3)C2OC(=O)c2ccc(O)c(F)c2)nn1 |
| InChI | InChI=1S/C29H29FN4O11/c30-18-7-14(1-2-19(18)36)29(41)45-28-26(15-8-21(38)25(40)22(39)9-15)44-23-11-17(35)10-20(37)24(23)27(28)43-13-16-12-34(33-32-16)4-6-42-5-3-31/h1-2,7-12,26-28,35-40H,3-6,13,31H2 |
| InChIKey | RFVWIJCBGIUCHJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 232.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|