C47H30BN5 — CID 168848126
5-[6-(3-isocyanocarbazol-9-yl)-2-(2,3,5,6-tetradeuterio-4-phenylphenyl)pyrimidin-4-yl]-6-phenylbenzo[c][1,2]benzazaborinine (PubChem CID 168848126) has the molecular formula C47H30BN5 and a molecular weight of 679.63 g/mol. Its IUPAC name is 5-[6-(3-isocyanocarbazol-9-yl)-2-(2,3,5,6-tetradeuterio-4-phenylphenyl)pyrimidin-4-yl]-6-phenylbenzo[c][1,2]benzazaborinine.
| Compound Name | 5-[6-(3-isocyanocarbazol-9-yl)-2-(2,3,5,6-tetradeuterio-4-phenylphenyl)pyrimidin-4-yl]-6-phenylbenzo[c][1,2]benzazaborinine |
|---|---|
| PubChem CID | 168848126 |
| Molecular Formula | C47H30BN5 |
| Molecular Weight | 679.63 g/mol |
| Exact Mass | 679.28 |
| IUPAC Name | 5-[6-(3-isocyanocarbazol-9-yl)-2-(2,3,5,6-tetradeuterio-4-phenylphenyl)pyrimidin-4-yl]-6-phenylbenzo[c][1,2]benzazaborinine |
| SMILES | [2H]c1c([2H])c(-c2nc(N3B(c4ccccc4)c4ccccc4-c4ccccc43)cc(-n3c4ccccc4c4cc([N+]#[C-])ccc43)n2)c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C47H30BN5/c1-49-36-28-29-43-40(30-36)39-20-9-12-22-42(39)52(43)45-31-46(51-47(50-45)34-26-24-33(25-27-34)32-14-4-2-5-15-32)53-44-23-13-10-19-38(44)37-18-8-11-21-41(37)48(53)35-16-6-3-7-17-35/h2-31H/i24D,25D,26D,27D |
| InChIKey | GCIKJRFXSOQIBH-ZTHNUDSJSA-N |
| XLogP | 10.38 |
| TPSA | 38.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.63 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|