C14H17BrO — CID 168848283
8-bromo-3,3,4,4-tetramethyl-2H-naphthalen-1-one (PubChem CID 168848283) has the molecular formula C14H17BrO and a molecular weight of 281.19 g/mol. Its IUPAC name is 8-bromo-3,3,4,4-tetramethyl-2H-naphthalen-1-one.
| Compound Name | 8-bromo-3,3,4,4-tetramethyl-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 168848283 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 8-bromo-3,3,4,4-tetramethyl-2H-naphthalen-1-one |
| SMILES | CC1(C)CC(=O)c2c(Br)cccc2C1(C)C |
| InChI | InChI=1S/C14H17BrO/c1-13(2)8-11(16)12-9(14(13,3)4)6-5-7-10(12)15/h5-7H,8H2,1-4H3 |
| InChIKey | PAGLOTAPHYUGLL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |