C37H28N3OPt-3 — CID 168848314
9-(4-tert-butyl-2-pyridinyl)-2-[3-(4-phenyl-2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum (PubChem CID 168848314) has the molecular formula C37H28N3OPt-3 and a molecular weight of 725.73 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[3-(4-phenyl-2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(4-phenyl-2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 168848314 |
| Molecular Formula | C37H28N3OPt-3 |
| Molecular Weight | 725.73 g/mol |
| Exact Mass | 725.19 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[3-(4-phenyl-2H-pyrrol-2-id-1-yl)benzene-2-id-1-yl]oxy-1H-carbazol-1-ide;platinum |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-]cc(-c6ccccc6)c5)ccc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C37H28N3O.Pt/c1-37(2,3)28-18-20-38-36(22-28)40-34-15-8-7-14-32(34)33-17-16-31(24-35(33)40)41-30-13-9-12-29(23-30)39-21-19-27(25-39)26-10-5-4-6-11-26;/h4-20,22,25H,1-3H3;/q-3; |
| InChIKey | OHSWJEWQQSHLQG-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.73 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|