C17H14Cl2N2O3 — CID 168849441
N-[(3,5-dichlorophenyl)-phenylmethyl]-2-oxo-1,3-oxazolidine-5-carboxamide (PubChem CID 168849441) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)-phenylmethyl]-2-oxo-1,3-oxazolidine-5-carboxamide.
| Compound Name | N-[(3,5-dichlorophenyl)-phenylmethyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 168849441 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | N-[(3,5-dichlorophenyl)-phenylmethyl]-2-oxo-1,3-oxazolidine-5-carboxamide |
| SMILES | O=C1NCC(C(=O)NC(c2ccccc2)c2cc(Cl)cc(Cl)c2)O1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c18-12-6-11(7-13(19)8-12)15(10-4-2-1-3-5-10)21-16(22)14-9-20-17(23)24-14/h1-8,14-15H,9H2,(H,20,23)(H,21,22) |
| InChIKey | WSGZXSYVLZSYAQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |