C27H43NO3 — CID 168849554
[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] N-heptylcarbamate (PubChem CID 168849554) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is [(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] N-heptylcarbamate.
| Compound Name | [(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] N-heptylcarbamate |
|---|---|
| PubChem CID | 168849554 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | [(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] N-heptylcarbamate |
| SMILES | CCCCCCCNC(=O)O[C@H]1CCC2C3CCC4=CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H43NO3/c1-4-5-6-7-8-17-28-25(30)31-24-12-11-22-21-10-9-19-18-20(29)13-15-26(19,2)23(21)14-16-27(22,24)3/h18,21-24H,4-17H2,1-3H3,(H,28,30)/t21?,22?,23?,24-,26-,27-/m0/s1 |
| InChIKey | RGBKDAUGUCKEKG-MXKDRNNCSA-N |
| XLogP | 6.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|