C30H35N3O7S2 — CID 168849876
[4-[[5-[4-methoxy-2-methyl-5-(morpholine-4-carbonyl)phenyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]phenyl] 3-butoxypropanoate (PubChem CID 168849876) has the molecular formula C30H35N3O7S2 and a molecular weight of 613.76 g/mol. Its IUPAC name is [4-[[5-[4-methoxy-2-methyl-5-(morpholine-4-carbonyl)phenyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]phenyl] 3-butoxypropanoate.
| Compound Name | [4-[[5-[4-methoxy-2-methyl-5-(morpholine-4-carbonyl)phenyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]phenyl] 3-butoxypropanoate |
|---|---|
| PubChem CID | 168849876 |
| Molecular Formula | C30H35N3O7S2 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | [4-[[5-[4-methoxy-2-methyl-5-(morpholine-4-carbonyl)phenyl]sulfanyl-1,3-thiazol-2-yl]carbamoyl]phenyl] 3-butoxypropanoate |
| SMILES | CCCCOCCC(=O)Oc1ccc(C(=O)Nc2ncc(Sc3cc(C(=O)N4CCOCC4)c(OC)cc3C)s2)cc1 |
| InChI | InChI=1S/C30H35N3O7S2/c1-4-5-13-38-14-10-26(34)40-22-8-6-21(7-9-22)28(35)32-30-31-19-27(42-30)41-25-18-23(24(37-3)17-20(25)2)29(36)33-11-15-39-16-12-33/h6-9,17-19H,4-5,10-16H2,1-3H3,(H,31,32,35) |
| InChIKey | GWKFWBDEPSYSGW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|