About 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one
2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one (PubChem CID 168850093) has the molecular formula C9H13N5O
and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one |
| PubChem CID | 168850093 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one |
| SMILES | CC(C)C1=NC2C(=O)NC(N)=NC2N=C1 |
| InChI | InChI=1S/C9H13N5O/c1-4(2)5-3-11-7-6(12-5)8(15)14-9(10)13-7/h3-4,6-7H,1-2H3,(H3,10,13,14,15) |
| InChIKey | VUFCXSPGVSCDRJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one?
The IUPAC name of 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one (CID 168850093) is 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one.
What is the SMILES notation for 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one?
The canonical SMILES for 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one is CC(C)C1=NC2C(=O)NC(N)=NC2N=C1.
What is the InChIKey of 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one?
The InChIKey is VUFCXSPGVSCDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5O/c1-4(2)5-3-11-7-6(12-5)8(15)14-9(10)13-7/h3-4,6-7H,1-2H3,(H3,10,13,14,15).
What are the key properties of 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one?
2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one has a molecular weight of 207.24 g/mol, XLogP of -0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-propan-2-yl-4a,8a-dihydro-3H-pteridin-4-one is sourced from PubChem (CID 168850093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).