About 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane
1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane (PubChem CID 168850099) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane.
Molecular Properties
| Compound Name | 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane |
| PubChem CID | 168850099 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane |
| SMILES | CC(C)(C)COC12CC(C(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C14H26O/c1-11(2,3)10-15-14-7-13(8-14,9-14)12(4,5)6/h7-10H2,1-6H3 |
| InChIKey | UTWRKEGCJWPAKU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane?
The IUPAC name of 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane (CID 168850099) is 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane.
What is the SMILES notation for 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane?
The canonical SMILES for 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane is CC(C)(C)COC12CC(C(C)(C)C)(C1)C2.
What is the InChIKey of 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane?
The InChIKey is UTWRKEGCJWPAKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O/c1-11(2,3)10-15-14-7-13(8-14,9-14)12(4,5)6/h7-10H2,1-6H3.
What are the key properties of 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane?
1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane has a molecular weight of 210.36 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-(2,2-dimethylpropoxy)bicyclo[1.1.1]pentane is sourced from PubChem (CID 168850099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).