C23H29N7O3 — CID 168850345
(7S)-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,2'-cyclohexane]-1'-one (PubChem CID 168850345) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (7S)-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,2'-cyclohexane]-1'-one.
| Compound Name | (7S)-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,2'-cyclohexane]-1'-one |
|---|---|
| PubChem CID | 168850345 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (7S)-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,2'-cyclohexane]-1'-one |
| SMILES | C[C@H](Oc1cc(N=[N+]=[N-])nc(-c2noc3c2CCC[C@@]32CCCCC2=O)n1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C23H29N7O3/c1-14(16-8-6-12-30(16)2)32-19-13-18(27-29-24)25-22(26-19)20-15-7-5-11-23(21(15)33-28-20)10-4-3-9-17(23)31/h13-14,16H,3-12H2,1-2H3/t14-,16-,23+/m0/s1 |
| InChIKey | JTOCUCVFFOSFHL-LZDHAAFVSA-N |
| XLogP | 4.65 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|