C15H30N2O2 — CID 168850650
tert-butyl (2R)-2,4-di(propan-2-yl)piperazine-1-carboxylate (PubChem CID 168850650) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is tert-butyl (2R)-2,4-di(propan-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2,4-di(propan-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 168850650 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | tert-butyl (2R)-2,4-di(propan-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)[C@@H]1CN(C(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)13-10-16(12(3)4)8-9-17(13)14(18)19-15(5,6)7/h11-13H,8-10H2,1-7H3/t13-/m0/s1 |
| InChIKey | PEACFXMKBMXPRL-ZDUSSCGKSA-N |
| XLogP | 2.97 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |