C26H29N9O2S — CID 168850880
(7S)-2'-amino-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,4'-6,7-dihydro-5H-1-benzothiophene]-3'-carbonitrile (PubChem CID 168850880) has the molecular formula C26H29N9O2S and a molecular weight of 531.65 g/mol. Its IUPAC name is (7S)-2'-amino-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,4'-6,7-dihydro-5H-1-benzothiophene]-3'-carbonitrile.
| Compound Name | (7S)-2'-amino-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,4'-6,7-dihydro-5H-1-benzothiophene]-3'-carbonitrile |
|---|---|
| PubChem CID | 168850880 |
| Molecular Formula | C26H29N9O2S |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (7S)-2'-amino-3-[4-azido-6-[(1S)-1-[(2S)-1-methylpyrrolidin-2-yl]ethoxy]pyrimidin-2-yl]spiro[5,6-dihydro-4H-1,2-benzoxazole-7,4'-6,7-dihydro-5H-1-benzothiophene]-3'-carbonitrile |
| SMILES | C[C@H](Oc1cc(N=[N+]=[N-])nc(-c2noc3c2CCC[C@@]32CCCc3sc(N)c(C#N)c32)n1)[C@@H]1CCCN1C |
| InChI | InChI=1S/C26H29N9O2S/c1-14(17-7-5-11-35(17)2)36-20-12-19(32-34-29)30-25(31-20)22-15-6-3-9-26(23(15)37-33-22)10-4-8-18-21(26)16(13-27)24(28)38-18/h12,14,17H,3-11,28H2,1-2H3/t14-,17-,26-/m0/s1 |
| InChIKey | MRTRZXZLZNXKJA-QAPORCKPSA-N |
| XLogP | 5.41 |
| TPSA | 162.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|