C39H35NO2S — CID 168851584
4-[4-(21,21-dimethyl-10-methylsulfanyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)phenyl]morpholine (PubChem CID 168851584) has the molecular formula C39H35NO2S and a molecular weight of 581.78 g/mol. Its IUPAC name is 4-[4-(21,21-dimethyl-10-methylsulfanyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)phenyl]morpholine.
| Compound Name | 4-[4-(21,21-dimethyl-10-methylsulfanyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 168851584 |
| Molecular Formula | C39H35NO2S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 4-[4-(21,21-dimethyl-10-methylsulfanyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15,17,19-nonaen-5-yl)phenyl]morpholine |
| SMILES | CSc1ccc2c3c(c4c(c2c1)OC(c1ccccc1)(c1ccc(N2CCOCC2)cc1)C=C4)C(C)(C)c1ccccc1-3 |
| InChI | InChI=1S/C39H35NO2S/c1-38(2)34-12-8-7-11-31(34)35-30-18-17-29(43-3)25-33(30)37-32(36(35)38)19-20-39(42-37,26-9-5-4-6-10-26)27-13-15-28(16-14-27)40-21-23-41-24-22-40/h4-20,25H,21-24H2,1-3H3 |
| InChIKey | YYVDPMPQPJGVHO-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|