C49H56F2O6Si — CID 168851685
tritert-butyl 2-[4-[10-fluoro-5-(4-fluorophenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate (PubChem CID 168851685) has the molecular formula C49H56F2O6Si and a molecular weight of 807.06 g/mol. Its IUPAC name is tritert-butyl 2-[4-[10-fluoro-5-(4-fluorophenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate.
| Compound Name | tritert-butyl 2-[4-[10-fluoro-5-(4-fluorophenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate |
|---|---|
| PubChem CID | 168851685 |
| Molecular Formula | C49H56F2O6Si |
| Molecular Weight | 807.06 g/mol |
| Exact Mass | 806.38 |
| IUPAC Name | tritert-butyl 2-[4-[10-fluoro-5-(4-fluorophenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1c3c(c4cc(F)ccc4c1-2)OC(c1ccc(F)cc1)(c1ccc(OCCO[Si](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C)cc1)C=C3 |
| InChI | InChI=1S/C49H56F2O6Si/c1-31-13-23-38-41(29-31)48(11,12)43-39-25-26-49(32-14-18-34(50)19-15-32,54-44(39)40-30-35(51)20-24-37(40)42(38)43)33-16-21-36(22-17-33)52-27-28-53-58(55-45(2,3)4,56-46(5,6)7)57-47(8,9)10/h13-26,29-30H,27-28H2,1-12H3 |
| InChIKey | LZKMVVRRKSZQQD-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.06 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|