C49H56F2O7Si — CID 168851862
tritert-butyl 2-[4-[10,18-difluoro-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate (PubChem CID 168851862) has the molecular formula C49H56F2O7Si and a molecular weight of 823.06 g/mol. Its IUPAC name is tritert-butyl 2-[4-[10,18-difluoro-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate.
| Compound Name | tritert-butyl 2-[4-[10,18-difluoro-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate |
|---|---|
| PubChem CID | 168851862 |
| Molecular Formula | C49H56F2O7Si |
| Molecular Weight | 823.06 g/mol |
| Exact Mass | 822.38 |
| IUPAC Name | tritert-butyl 2-[4-[10,18-difluoro-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenoxy]ethyl silicate |
| SMILES | COc1ccc(C2(c3ccc(OCCO[Si](OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C)cc3)C=Cc3c4c(c5ccc(F)cc5c3O2)-c2ccc(F)cc2C4(C)C)cc1 |
| InChI | InChI=1S/C49H56F2O7Si/c1-45(2,3)56-59(57-46(4,5)6,58-47(7,8)9)54-28-27-53-36-21-15-32(16-22-36)49(31-13-19-35(52-12)20-14-31)26-25-39-43-42(37-23-17-33(50)29-40(37)44(39)55-49)38-24-18-34(51)30-41(38)48(43,10)11/h13-26,29-30H,27-28H2,1-12H3 |
| InChIKey | DSWALBPMJOAIJP-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.06 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|