C21H20N2O2S — CID 168853496
4-[[4-[(4-methylsulfanylphenoxy)methyl]-2-pyridinyl]methyl]benzamide (PubChem CID 168853496) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-[[4-[(4-methylsulfanylphenoxy)methyl]-2-pyridinyl]methyl]benzamide.
| Compound Name | 4-[[4-[(4-methylsulfanylphenoxy)methyl]-2-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 168853496 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[[4-[(4-methylsulfanylphenoxy)methyl]-2-pyridinyl]methyl]benzamide |
| SMILES | CSc1ccc(OCc2ccnc(Cc3ccc(C(N)=O)cc3)c2)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-26-20-8-6-19(7-9-20)25-14-16-10-11-23-18(13-16)12-15-2-4-17(5-3-15)21(22)24/h2-11,13H,12,14H2,1H3,(H2,22,24) |
| InChIKey | XJWZFCIBCKJRGH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |