About 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide
4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 168853789) has the molecular formula C20H15Cl3N2O2
and a molecular weight of 421.71 g/mol. Its IUPAC name is 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide |
| PubChem CID | 168853789 |
| Molecular Formula | C20H15Cl3N2O2 |
| Molecular Weight | 421.71 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(Cl)cc1O)N(Cc1cccnc1)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl3N2O2/c21-15-4-3-14(18(23)8-15)12-25(11-13-2-1-7-24-10-13)20(27)17-6-5-16(22)9-19(17)26/h1-10,26H,11-12H2 |
| InChIKey | LESMAWDPGRVNQW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.71 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide?
The IUPAC name of 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide (CID 168853789) is 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide.
What is the SMILES notation for 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide?
The canonical SMILES for 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide is O=C(c1ccc(Cl)cc1O)N(Cc1cccnc1)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide?
The InChIKey is LESMAWDPGRVNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15Cl3N2O2/c21-15-4-3-14(18(23)8-15)12-25(11-13-2-1-7-24-10-13)20(27)17-6-5-16(22)9-19(17)26/h1-10,26H,11-12H2.
What are the key properties of 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide?
4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide has a molecular weight of 421.71 g/mol, XLogP of 5.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(2,4-dichlorophenyl)methyl]-2-hydroxy-N-(pyridin-3-ylmethyl)benzamide is sourced from PubChem (CID 168853789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).