C31H41ClN6O4 — CID 168854440
tert-butyl N-[5-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoyl]amino]pentyl]carbamate (PubChem CID 168854440) has the molecular formula C31H41ClN6O4 and a molecular weight of 597.16 g/mol. Its IUPAC name is tert-butyl N-[5-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoyl]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoyl]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 168854440 |
| Molecular Formula | C31H41ClN6O4 |
| Molecular Weight | 597.16 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | tert-butyl N-[5-[[(2R)-2-[(4S)-6-(4-chlorophenyl)-8-methoxy-1-methyl-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]propanoyl]amino]pentyl]carbamate |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)N[C@@H]([C@@H](C)C(=O)NCCCCCNC(=O)OC(C)(C)C)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H41ClN6O4/c1-19(29(39)33-16-8-7-9-17-34-30(40)42-31(3,4)5)26-28-37-36-20(2)38(28)25-15-14-23(41-6)18-24(25)27(35-26)21-10-12-22(32)13-11-21/h10-15,18-19,26-27,35H,7-9,16-17H2,1-6H3,(H,33,39)(H,34,40)/t19-,26+,27?/m1/s1 |
| InChIKey | GJGAXANOBQHADD-SXYYHFOHSA-N |
| XLogP | 5.42 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.16 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|