C24H33NO2 — CID 168854743
[(1S,3R,4R)-1-ethenyl-4-prop-1-en-2-yl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]cyclohexyl]methyl formate (PubChem CID 168854743) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is [(1S,3R,4R)-1-ethenyl-4-prop-1-en-2-yl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]cyclohexyl]methyl formate.
| Compound Name | [(1S,3R,4R)-1-ethenyl-4-prop-1-en-2-yl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]cyclohexyl]methyl formate |
|---|---|
| PubChem CID | 168854743 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | [(1S,3R,4R)-1-ethenyl-4-prop-1-en-2-yl-3-[4-(pyrrolidin-1-ylmethyl)phenyl]cyclohexyl]methyl formate |
| SMILES | C=C[C@]1(COC=O)CC[C@@H](C(=C)C)[C@H](c2ccc(CN3CCCC3)cc2)C1 |
| InChI | InChI=1S/C24H33NO2/c1-4-24(17-27-18-26)12-11-22(19(2)3)23(15-24)21-9-7-20(8-10-21)16-25-13-5-6-14-25/h4,7-10,18,22-23H,1-2,5-6,11-17H2,3H3/t22-,23-,24-/m0/s1 |
| InChIKey | DIBVONHFYPNQAT-HJOGWXRNSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|