C26H40BBrN2O5 — CID 168857150
tert-butyl (2S,5S)-5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate (PubChem CID 168857150) has the molecular formula C26H40BBrN2O5 and a molecular weight of 551.33 g/mol. Its IUPAC name is tert-butyl (2S,5S)-5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5S)-5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 168857150 |
| Molecular Formula | C26H40BBrN2O5 |
| Molecular Weight | 551.33 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | tert-butyl (2S,5S)-5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylate |
| SMILES | CN1C(=O)[C@H](Cc2ccc(Br)cc2B2OC(C)(C)C(C)(C)O2)N(C(=O)OC(C)(C)C)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C26H40BBrN2O5/c1-23(2,3)21-29(11)20(31)19(30(21)22(32)33-24(4,5)6)14-16-12-13-17(28)15-18(16)27-34-25(7,8)26(9,10)35-27/h12-13,15,19,21H,14H2,1-11H3/t19-,21-/m0/s1 |
| InChIKey | ZESQVFUEVSVETG-FPOVZHCZSA-N |
| XLogP | 4.74 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|