About [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate
[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 168857159) has the molecular formula C16H17F3O3
and a molecular weight of 314.30 g/mol. Its IUPAC name is [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate.
Molecular Properties
| Compound Name | [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate |
| PubChem CID | 168857159 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | O=C(CCc1ccc(C(F)(F)F)cc1)OC[C@H]1CCC=CO1 |
| InChI | InChI=1S/C16H17F3O3/c17-16(18,19)13-7-4-12(5-8-13)6-9-15(20)22-11-14-3-1-2-10-21-14/h2,4-5,7-8,10,14H,1,3,6,9,11H2/t14-/m1/s1 |
| InChIKey | FTNRHRDCPJHEQF-CQSZACIVSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate?
The IUPAC name of [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate (CID 168857159) is [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate.
What is the SMILES notation for [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate?
The canonical SMILES for [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate is O=C(CCc1ccc(C(F)(F)F)cc1)OC[C@H]1CCC=CO1.
What is the InChIKey of [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate?
The InChIKey is FTNRHRDCPJHEQF-CQSZACIVSA-N. The full InChI is InChI=1S/C16H17F3O3/c17-16(18,19)13-7-4-12(5-8-13)6-9-15(20)22-11-14-3-1-2-10-21-14/h2,4-5,7-8,10,14H,1,3,6,9,11H2/t14-/m1/s1.
What are the key properties of [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate?
[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate has a molecular weight of 314.30 g/mol, XLogP of 3.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3,4-dihydro-2H-pyran-2-yl]methyl 3-[4-(trifluoromethyl)phenyl]propanoate is sourced from PubChem (CID 168857159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).