C24H34F3N5O6 — CID 168857383
(2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-4-methyl-N-[(2S)-4-(methylamino)-3,4-dioxo-1-(2-oxo-1H-pyridin-3-yl)butan-2-yl]pentanamide (PubChem CID 168857383) has the molecular formula C24H34F3N5O6 and a molecular weight of 545.56 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-4-methyl-N-[(2S)-4-(methylamino)-3,4-dioxo-1-(2-oxo-1H-pyridin-3-yl)butan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-4-methyl-N-[(2S)-4-(methylamino)-3,4-dioxo-1-(2-oxo-1H-pyridin-3-yl)butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 168857383 |
| Molecular Formula | C24H34F3N5O6 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | (2S)-2-[[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]amino]-4-methyl-N-[(2S)-4-(methylamino)-3,4-dioxo-1-(2-oxo-1H-pyridin-3-yl)butan-2-yl]pentanamide |
| SMILES | CNC(=O)C(=O)[C@H](Cc1ccc[nH]c1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C24H34F3N5O6/c1-12(2)10-15(31-21(37)17(23(3,4)5)32-22(38)24(25,26)27)19(35)30-14(16(33)20(36)28-6)11-13-8-7-9-29-18(13)34/h7-9,12,14-15,17H,10-11H2,1-6H3,(H,28,36)(H,29,34)(H,30,35)(H,31,37)(H,32,38)/t14-,15-,17+/m0/s1 |
| InChIKey | SCAHLSWYFUIDCU-YQQAZPJKSA-N |
| XLogP | 0.34 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|