C58H41N4OPtS-3 — CID 168857737
CID 168857737 (PubChem CID 168857737) has the molecular formula C58H41N4OPtS-3 and a molecular weight of 1037.14 g/mol.
| Compound Name | CID 168857737 |
|---|---|
| PubChem CID | 168857737 |
| Molecular Formula | C58H41N4OPtS-3 |
| Molecular Weight | 1037.14 g/mol |
| Exact Mass | 1036.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6c(-c7ccccc7)cccc6-c6ccccc6)c6ccccc65)ccc4)ccc3c3sc4ccc5ccccc5c4c32)c1.[Pt] |
| InChI | InChI=1S/C58H41N4OS.Pt/c1-58(2,3)41-32-33-59-53(34-41)62-51-36-44(29-30-48(51)57-56(62)54-45-23-11-10-20-40(45)28-31-52(54)64-57)63-43-22-14-21-42(35-43)60-37-61(50-27-13-12-26-49(50)60)55-46(38-16-6-4-7-17-38)24-15-25-47(55)39-18-8-5-9-19-39;/h4-34,37H,1-3H3;/q-3; |
| InChIKey | WVLZKAQNXGEKME-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.14 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|