About [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate
[2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate (PubChem CID 168857898) has the molecular formula C37H70O6
and a molecular weight of 610.96 g/mol. Its IUPAC name is [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate.
Molecular Properties
| Compound Name | [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate |
| PubChem CID | 168857898 |
| Molecular Formula | C37H70O6 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.52 |
| IUPAC Name | [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CC(=O)OCC(CCCCOC1CCCCO1)COC(=O)CCCCC |
| InChI | InChI=1S/C37H70O6/c1-4-7-10-12-14-17-23-33(24-18-15-13-11-8-5-2)30-36(39)43-32-34(31-42-35(38)26-16-9-6-3)25-19-21-28-40-37-27-20-22-29-41-37/h33-34,37H,4-32H2,1-3H3 |
| InChIKey | URXMSEBYBMDTNL-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate?
The IUPAC name of [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate (CID 168857898) is [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate.
What is the SMILES notation for [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate?
The canonical SMILES for [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate is CCCCCCCCC(CCCCCCCC)CC(=O)OCC(CCCCOC1CCCCO1)COC(=O)CCCCC.
What is the InChIKey of [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate?
The InChIKey is URXMSEBYBMDTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H70O6/c1-4-7-10-12-14-17-23-33(24-18-15-13-11-8-5-2)30-36(39)43-32-34(31-42-35(38)26-16-9-6-3)25-19-21-28-40-37-27-20-22-29-41-37/h33-34,37H,4-32H2,1-3H3.
What are the key properties of [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate?
[2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate has a molecular weight of 610.96 g/mol, XLogP of 10.49, 30 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hexanoyloxymethyl)-6-(oxan-2-yloxy)hexyl] 3-octylundecanoate is sourced from PubChem (CID 168857898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).