C36H40 — CID 168858121
4-[5-[2,4-dimethyl-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)cyclopenta-1,4-dien-1-yl]-2-methylidenehex-5-enyl]-1-methylidene-2H-naphthalene (PubChem CID 168858121) has the molecular formula C36H40 and a molecular weight of 472.72 g/mol. Its IUPAC name is 4-[5-[2,4-dimethyl-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)cyclopenta-1,4-dien-1-yl]-2-methylidenehex-5-enyl]-1-methylidene-2H-naphthalene.
| Compound Name | 4-[5-[2,4-dimethyl-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)cyclopenta-1,4-dien-1-yl]-2-methylidenehex-5-enyl]-1-methylidene-2H-naphthalene |
|---|---|
| PubChem CID | 168858121 |
| Molecular Formula | C36H40 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 4-[5-[2,4-dimethyl-3-(1,2,3,4-tetrahydronaphthalen-2-ylmethyl)cyclopenta-1,4-dien-1-yl]-2-methylidenehex-5-enyl]-1-methylidene-2H-naphthalene |
| SMILES | C=C(CCC(=C)C1=C(C)C(CC2CCc3ccccc3C2)C(C)=C1)CC1=CCC(=C)c2ccccc21 |
| InChI | InChI=1S/C36H40/c1-24(20-32-18-16-25(2)33-12-8-9-13-34(32)33)14-15-26(3)35-21-27(4)36(28(35)5)23-29-17-19-30-10-6-7-11-31(30)22-29/h6-13,18,21,29,36H,1-3,14-17,19-20,22-23H2,4-5H3 |
| InChIKey | PFJFIENWZOWAHM-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|