C20H21N3O3 — CID 168858474
N-methyl-N-(oxan-4-yl)-5-(1-phenylpyrazol-4-yl)furan-2-carboxamide (PubChem CID 168858474) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-methyl-N-(oxan-4-yl)-5-(1-phenylpyrazol-4-yl)furan-2-carboxamide.
| Compound Name | N-methyl-N-(oxan-4-yl)-5-(1-phenylpyrazol-4-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 168858474 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-methyl-N-(oxan-4-yl)-5-(1-phenylpyrazol-4-yl)furan-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(-c2cnn(-c3ccccc3)c2)o1)C1CCOCC1 |
| InChI | InChI=1S/C20H21N3O3/c1-22(16-9-11-25-12-10-16)20(24)19-8-7-18(26-19)15-13-21-23(14-15)17-5-3-2-4-6-17/h2-8,13-14,16H,9-12H2,1H3 |
| InChIKey | GXFLRUAKJGICSK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |