About 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one
5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one (PubChem CID 168858675) has the molecular formula C17H14N2O3Se
and a molecular weight of 373.27 g/mol. Its IUPAC name is 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one |
| PubChem CID | 168858675 |
| Molecular Formula | C17H14N2O3Se |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one |
| SMILES | CN1C(=[Se])N(c2ccccc2)C(=O)C1=Cc1cccc(O)c1O |
| InChI | InChI=1S/C17H14N2O3Se/c1-18-13(10-11-6-5-9-14(20)15(11)21)16(22)19(17(18)23)12-7-3-2-4-8-12/h2-10,20-21H,1H3 |
| InChIKey | GLKNKJMFQHNJBD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one?
The IUPAC name of 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one (CID 168858675) is 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one.
What is the SMILES notation for 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one?
The canonical SMILES for 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one is CN1C(=[Se])N(c2ccccc2)C(=O)C1=Cc1cccc(O)c1O.
What is the InChIKey of 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one?
The InChIKey is GLKNKJMFQHNJBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3Se/c1-18-13(10-11-6-5-9-14(20)15(11)21)16(22)19(17(18)23)12-7-3-2-4-8-12/h2-10,20-21H,1H3.
What are the key properties of 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one?
5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one has a molecular weight of 373.27 g/mol, XLogP of 1.67, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dihydroxyphenyl)methylidene]-1-methyl-3-phenyl-2-selanylideneimidazolidin-4-one is sourced from PubChem (CID 168858675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).