C12H13F3N4O — CID 168859266
2-methoxy-3-[5-methyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]aniline (PubChem CID 168859266) has the molecular formula C12H13F3N4O and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-methoxy-3-[5-methyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-methoxy-3-[5-methyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 168859266 |
| Molecular Formula | C12H13F3N4O |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-methoxy-3-[5-methyl-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-3-yl]aniline |
| SMILES | COc1c(N)cccc1-c1nc(C)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C12H13F3N4O/c1-7-17-11(18-19(7)6-12(13,14)15)8-4-3-5-9(16)10(8)20-2/h3-5H,6,16H2,1-2H3 |
| InChIKey | QNYLCTYNHFCKOZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|