C19H28ClN3O7 — CID 168859991
2-(1,2-dihydroxypyrrolidin-3-yl)-5-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]isoindole-1,3-dione;hydrochloride (PubChem CID 168859991) has the molecular formula C19H28ClN3O7 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(1,2-dihydroxypyrrolidin-3-yl)-5-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-(1,2-dihydroxypyrrolidin-3-yl)-5-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 168859991 |
| Molecular Formula | C19H28ClN3O7 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 2-(1,2-dihydroxypyrrolidin-3-yl)-5-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]isoindole-1,3-dione;hydrochloride |
| SMILES | CNCCOCCOCCOc1ccc2c(c1)C(=O)N(C1CCN(O)C1O)C2=O.Cl |
| InChI | InChI=1S/C19H27N3O7.ClH/c1-20-5-7-27-8-9-28-10-11-29-13-2-3-14-15(12-13)18(24)22(17(14)23)16-4-6-21(26)19(16)25;/h2-3,12,16,19-20,25-26H,4-11H2,1H3;1H |
| InChIKey | JTVOIFFEDDJVLU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|