About 1-prop-2-enoxy-2,3-dihydroinden-1-amine
1-prop-2-enoxy-2,3-dihydroinden-1-amine (PubChem CID 168860532) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-prop-2-enoxy-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 1-prop-2-enoxy-2,3-dihydroinden-1-amine |
| PubChem CID | 168860532 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1-prop-2-enoxy-2,3-dihydroinden-1-amine |
| SMILES | C=CCOC1(N)CCc2ccccc21 |
| InChI | InChI=1S/C12H15NO/c1-2-9-14-12(13)8-7-10-5-3-4-6-11(10)12/h2-6H,1,7-9,13H2 |
| InChIKey | HMCHUDYQGWFBQM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enoxy-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enoxy-2,3-dihydroinden-1-amine?
The IUPAC name of 1-prop-2-enoxy-2,3-dihydroinden-1-amine (CID 168860532) is 1-prop-2-enoxy-2,3-dihydroinden-1-amine.
What is the SMILES notation for 1-prop-2-enoxy-2,3-dihydroinden-1-amine?
The canonical SMILES for 1-prop-2-enoxy-2,3-dihydroinden-1-amine is C=CCOC1(N)CCc2ccccc21.
What is the InChIKey of 1-prop-2-enoxy-2,3-dihydroinden-1-amine?
The InChIKey is HMCHUDYQGWFBQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-2-9-14-12(13)8-7-10-5-3-4-6-11(10)12/h2-6H,1,7-9,13H2.
What are the key properties of 1-prop-2-enoxy-2,3-dihydroinden-1-amine?
1-prop-2-enoxy-2,3-dihydroinden-1-amine has a molecular weight of 189.26 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enoxy-2,3-dihydroinden-1-amine is sourced from PubChem (CID 168860532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).