C17H16ClF3N4 — CID 168861351
2-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 168861351) has the molecular formula C17H16ClF3N4 and a molecular weight of 368.79 g/mol. Its IUPAC name is 2-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | 2-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 168861351 |
| Molecular Formula | C17H16ClF3N4 |
| Molecular Weight | 368.79 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2-[6-chloro-4-(2,3,4-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | NC1CC2CN(c3nnc(Cl)cc3-c3ccc(F)c(F)c3F)CC2C1 |
| InChI | InChI=1S/C17H16ClF3N4/c18-14-5-12(11-1-2-13(19)16(21)15(11)20)17(24-23-14)25-6-8-3-10(22)4-9(8)7-25/h1-2,5,8-10H,3-4,6-7,22H2 |
| InChIKey | LRAOAERXHMITHT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|