About methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate
methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate (PubChem CID 168861760) has the molecular formula C12H21NO4Si
and a molecular weight of 271.39 g/mol. Its IUPAC name is methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate |
| PubChem CID | 168861760 |
| Molecular Formula | C12H21NO4Si |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1conc1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H21NO4Si/c1-12(2,3)18(5,6)17-8-10-9(7-16-13-10)11(14)15-4/h7H,8H2,1-6H3 |
| InChIKey | HHBXYVLFQHTJKW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate (CID 168861760) is methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate is COC(=O)c1conc1CO[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate?
The InChIKey is HHBXYVLFQHTJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4Si/c1-12(2,3)18(5,6)17-8-10-9(7-16-13-10)11(14)15-4/h7H,8H2,1-6H3.
What are the key properties of methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate?
methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate has a molecular weight of 271.39 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 168861760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).