C16H20BNO2 — CID 168861804
2-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile (PubChem CID 168861804) has the molecular formula C16H20BNO2 and a molecular weight of 269.15 g/mol. Its IUPAC name is 2-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile.
| Compound Name | 2-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile |
|---|---|
| PubChem CID | 168861804 |
| Molecular Formula | C16H20BNO2 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]benzonitrile |
| SMILES | CC1(C)OB([C@H]2C[C@@H]2c2ccccc2C#N)OC1(C)C |
| InChI | InChI=1S/C16H20BNO2/c1-15(2)16(3,4)20-17(19-15)14-9-13(14)12-8-6-5-7-11(12)10-18/h5-8,13-14H,9H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | HVUMQFYBKULTET-KGLIPLIRSA-N |
| XLogP | 3.51 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|