C12H15F2NO5 — CID 168862024
(2R,3R,4R,5S)-1-(2,6-difluorophenoxy)-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 168862024) has the molecular formula C12H15F2NO5 and a molecular weight of 291.25 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-(2,6-difluorophenoxy)-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-(2,6-difluorophenoxy)-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 168862024 |
| Molecular Formula | C12H15F2NO5 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (2R,3R,4R,5S)-1-(2,6-difluorophenoxy)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1Oc1c(F)cccc1F |
| InChI | InChI=1S/C12H15F2NO5/c13-6-2-1-3-7(14)12(6)20-15-4-9(17)11(19)10(18)8(15)5-16/h1-3,8-11,16-19H,4-5H2/t8-,9+,10-,11-/m1/s1 |
| InChIKey | PCZQGZMJCWZMDG-LMLFDSFASA-N |
| XLogP | -0.98 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |