About 2,4,5-trioxohexanal
2,4,5-trioxohexanal (PubChem CID 168862046) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is 2,4,5-trioxohexanal.
Molecular Properties
| Compound Name | 2,4,5-trioxohexanal |
| PubChem CID | 168862046 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2,4,5-trioxohexanal |
| SMILES | CC(=O)C(=O)CC(=O)C=O |
| InChI | InChI=1S/C6H6O4/c1-4(8)6(10)2-5(9)3-7/h3H,2H2,1H3 |
| InChIKey | GPIFCHFPYCMSRY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trioxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trioxohexanal?
The IUPAC name of 2,4,5-trioxohexanal (CID 168862046) is 2,4,5-trioxohexanal.
What is the SMILES notation for 2,4,5-trioxohexanal?
The canonical SMILES for 2,4,5-trioxohexanal is CC(=O)C(=O)CC(=O)C=O.
What is the InChIKey of 2,4,5-trioxohexanal?
The InChIKey is GPIFCHFPYCMSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4/c1-4(8)6(10)2-5(9)3-7/h3H,2H2,1H3.
What are the key properties of 2,4,5-trioxohexanal?
2,4,5-trioxohexanal has a molecular weight of 142.11 g/mol, XLogP of -0.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trioxohexanal is sourced from PubChem (CID 168862046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).