About 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde
4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 168862197) has the molecular formula C14H16FN5O2
and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde |
| PubChem CID | 168862197 |
| Molecular Formula | C14H16FN5O2 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2ncc(F)c(C(=O)N3CC=CC3)n2)CC1 |
| InChI | InChI=1S/C14H16FN5O2/c15-11-9-16-14(20-7-5-18(10-21)6-8-20)17-12(11)13(22)19-3-1-2-4-19/h1-2,9-10H,3-8H2 |
| InChIKey | LDGLAGVHFXQUAA-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde?
The IUPAC name of 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde (CID 168862197) is 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde.
What is the SMILES notation for 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde?
The canonical SMILES for 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde is O=CN1CCN(c2ncc(F)c(C(=O)N3CC=CC3)n2)CC1.
What is the InChIKey of 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde?
The InChIKey is LDGLAGVHFXQUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN5O2/c15-11-9-16-14(20-7-5-18(10-21)6-8-20)17-12(11)13(22)19-3-1-2-4-19/h1-2,9-10H,3-8H2.
What are the key properties of 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde?
4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde has a molecular weight of 305.31 g/mol, XLogP of -0.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,5-dihydropyrrole-1-carbonyl)-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde is sourced from PubChem (CID 168862197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).