C9H17ClN2O — CID 168862236
N-chloro-3-(2-methylpropyl)pyrrolidine-1-carboxamide (PubChem CID 168862236) has the molecular formula C9H17ClN2O and a molecular weight of 204.70 g/mol. Its IUPAC name is N-chloro-3-(2-methylpropyl)pyrrolidine-1-carboxamide.
| Compound Name | N-chloro-3-(2-methylpropyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 168862236 |
| Molecular Formula | C9H17ClN2O |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | N-chloro-3-(2-methylpropyl)pyrrolidine-1-carboxamide |
| SMILES | CC(C)CC1CCN(C(=O)NCl)C1 |
| InChI | InChI=1S/C9H17ClN2O/c1-7(2)5-8-3-4-12(6-8)9(13)11-10/h7-8H,3-6H2,1-2H3,(H,11,13) |
| InChIKey | QHLYJZPCWRFLHX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|