C47H58N6O6 — CID 168862312
(3S,4S)-1-[4-[3-(ethylcarbamoyl)-4-octanoylpiperazine-1-carbonyl]benzoyl]-3-N,4-N-bis[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide (PubChem CID 168862312) has the molecular formula C47H58N6O6 and a molecular weight of 803.02 g/mol. Its IUPAC name is (3S,4S)-1-[4-[3-(ethylcarbamoyl)-4-octanoylpiperazine-1-carbonyl]benzoyl]-3-N,4-N-bis[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide.
| Compound Name | (3S,4S)-1-[4-[3-(ethylcarbamoyl)-4-octanoylpiperazine-1-carbonyl]benzoyl]-3-N,4-N-bis[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide |
|---|---|
| PubChem CID | 168862312 |
| Molecular Formula | C47H58N6O6 |
| Molecular Weight | 803.02 g/mol |
| Exact Mass | 802.44 |
| IUPAC Name | (3S,4S)-1-[4-[3-(ethylcarbamoyl)-4-octanoylpiperazine-1-carbonyl]benzoyl]-3-N,4-N-bis[(1S,2R)-2-phenylcyclopropyl]pyrrolidine-3,4-dicarboxamide |
| SMILES | CCCCCCCC(=O)N1CCN(C(=O)c2ccc(C(=O)N3C[C@@H](C(=O)N[C@H]4C[C@@H]4c4ccccc4)[C@H](C(=O)N[C@H]4C[C@@H]4c4ccccc4)C3)cc2)CC1C(=O)NCC |
| InChI | InChI=1S/C47H58N6O6/c1-3-5-6-7-14-19-42(54)53-25-24-51(30-41(53)45(57)48-4-2)46(58)33-20-22-34(23-21-33)47(59)52-28-37(43(55)49-39-26-35(39)31-15-10-8-11-16-31)38(29-52)44(56)50-40-27-36(40)32-17-12-9-13-18-32/h8-13,15-18,20-23,35-41H,3-7,14,19,24-30H2,1-2H3,(H,48,57)(H,49,55)(H,50,56)/t35-,36-,37-,38-,39+,40+,41?/m1/s1 |
| InChIKey | NCAZLPBVLRRHCH-AGJNUBLKSA-N |
| XLogP | 4.87 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|