C12H13F3N2O3 — CID 168862371
[4-nitro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methanol (PubChem CID 168862371) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is [4-nitro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methanol.
| Compound Name | [4-nitro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methanol |
|---|---|
| PubChem CID | 168862371 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [4-nitro-2-[3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(CO)c(N2CCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c13-12(14,15)9-3-4-16(6-9)11-5-10(17(19)20)2-1-8(11)7-18/h1-2,5,9,18H,3-4,6-7H2 |
| InChIKey | VIVSBMBVUQNLEG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|