C17H13ClF3N5O3 — CID 168862383
(1S,8E,9R)-N-[3-chloro-4-(trifluoromethyl)phenyl]-8-hydroxyimino-5-oxo-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-12-carboxamide (PubChem CID 168862383) has the molecular formula C17H13ClF3N5O3 and a molecular weight of 427.77 g/mol. Its IUPAC name is (1S,8E,9R)-N-[3-chloro-4-(trifluoromethyl)phenyl]-8-hydroxyimino-5-oxo-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-12-carboxamide.
| Compound Name | (1S,8E,9R)-N-[3-chloro-4-(trifluoromethyl)phenyl]-8-hydroxyimino-5-oxo-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-12-carboxamide |
|---|---|
| PubChem CID | 168862383 |
| Molecular Formula | C17H13ClF3N5O3 |
| Molecular Weight | 427.77 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (1S,8E,9R)-N-[3-chloro-4-(trifluoromethyl)phenyl]-8-hydroxyimino-5-oxo-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2(7),3-diene-12-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(Cl)c1)N1[C@@H]2CC[C@H]1c1cnc(=O)[nH]c1/C2=N/O |
| InChI | InChI=1S/C17H13ClF3N5O3/c18-10-5-7(1-2-9(10)17(19,20)21)23-16(28)26-11-3-4-12(26)14(25-29)13-8(11)6-22-15(27)24-13/h1-2,5-6,11-12,29H,3-4H2,(H,23,28)(H,22,24,27)/b25-14+/t11-,12+/m0/s1 |
| InChIKey | YWGMRTPWJGHVNO-ASLBQZEQSA-N |
| XLogP | 3.37 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|