C10H10F2N2 — CID 168862423
5,6-difluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 168862423) has the molecular formula C10H10F2N2 and a molecular weight of 196.20 g/mol. Its IUPAC name is 5,6-difluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | 5,6-difluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 168862423 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 5,6-difluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | Fc1ncc2c(c1F)CC1CCC2N1 |
| InChI | InChI=1S/C10H10F2N2/c11-9-6-3-5-1-2-8(14-5)7(6)4-13-10(9)12/h4-5,8,14H,1-3H2 |
| InChIKey | KNTUNEXXOPIKCB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|