C17H14BrN5O — CID 168862515
(1S,9R)-N-(3-bromo-4-cyanophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 168862515) has the molecular formula C17H14BrN5O and a molecular weight of 384.24 g/mol. Its IUPAC name is (1S,9R)-N-(3-bromo-4-cyanophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | (1S,9R)-N-(3-bromo-4-cyanophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862515 |
| Molecular Formula | C17H14BrN5O |
| Molecular Weight | 384.24 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | (1S,9R)-N-(3-bromo-4-cyanophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)N2[C@@H]3CC[C@H]2c2cncnc2C3)cc1Br |
| InChI | InChI=1S/C17H14BrN5O/c18-14-5-11(2-1-10(14)7-19)22-17(24)23-12-3-4-16(23)13-8-20-9-21-15(13)6-12/h1-2,5,8-9,12,16H,3-4,6H2,(H,22,24)/t12-,16+/m1/s1 |
| InChIKey | GPOZDPHTUAWKGK-WBMJQRKESA-N |
| XLogP | 3.40 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |