C10H12N2 — CID 168862556
5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 168862556) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 168862556 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | c1cc2c(cn1)CC1CCC2N1 |
| InChI | InChI=1S/C10H12N2/c1-2-10-9-3-4-11-6-7(9)5-8(1)12-10/h3-4,6,8,10,12H,1-2,5H2 |
| InChIKey | USEABLYZYCYANQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |