About 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene
7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 168862881) has the molecular formula C8H6F2
and a molecular weight of 140.13 g/mol. Its IUPAC name is 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene.
Molecular Properties
| Compound Name | 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene |
| PubChem CID | 168862881 |
| Molecular Formula | C8H6F2 |
| Molecular Weight | 140.13 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | FC1(F)Cc2ccccc21 |
| InChI | InChI=1S/C8H6F2/c9-8(10)5-6-3-1-2-4-7(6)8/h1-4H,5H2 |
| InChIKey | BOOSMCQBTGLJIH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.13 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene?
The IUPAC name of 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene (CID 168862881) is 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene.
What is the SMILES notation for 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene?
The canonical SMILES for 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene is FC1(F)Cc2ccccc21.
What is the InChIKey of 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene?
The InChIKey is BOOSMCQBTGLJIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F2/c9-8(10)5-6-3-1-2-4-7(6)8/h1-4H,5H2.
What are the key properties of 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene?
7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene has a molecular weight of 140.13 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-difluorobicyclo[4.2.0]octa-1,3,5-triene is sourced from PubChem (CID 168862881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).