About N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine
N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine (PubChem CID 168864510) has the molecular formula C11H9Cl2F2NO
and a molecular weight of 280.10 g/mol. Its IUPAC name is N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine.
Molecular Properties
| Compound Name | N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine |
| PubChem CID | 168864510 |
| Molecular Formula | C11H9Cl2F2NO |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine |
| SMILES | C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)ON=CC |
| InChI | InChI=1S/C11H9Cl2F2NO/c1-3-16-17-11(14,15)7(2)8-4-9(12)6-10(13)5-8/h3-6H,2H2,1H3 |
| InChIKey | ZJKXPKXZPDGGDC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine?
The IUPAC name of N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine (CID 168864510) is N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine.
What is the SMILES notation for N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine?
The canonical SMILES for N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine is C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)ON=CC.
What is the InChIKey of N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine?
The InChIKey is ZJKXPKXZPDGGDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9Cl2F2NO/c1-3-16-17-11(14,15)7(2)8-4-9(12)6-10(13)5-8/h3-6H,2H2,1H3.
What are the key properties of N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine?
N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine has a molecular weight of 280.10 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,5-dichlorophenyl)-1,1-difluoroprop-2-enoxy]ethanimine is sourced from PubChem (CID 168864510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).