About 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione
5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione (PubChem CID 168864617) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 168864617 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione |
| SMILES | C=CC1(c2ccccc2)OC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H13NO3/c1-2-17(13-9-5-3-6-10-13)15(19)18(16(20)21-17)14-11-7-4-8-12-14/h2-12H,1H2 |
| InChIKey | NHAGVHDIYSMUOM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione (CID 168864617) is 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione is C=CC1(c2ccccc2)OC(=O)N(c2ccccc2)C1=O.
What is the InChIKey of 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione?
The InChIKey is NHAGVHDIYSMUOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c1-2-17(13-9-5-3-6-10-13)15(19)18(16(20)21-17)14-11-7-4-8-12-14/h2-12H,1H2.
What are the key properties of 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione?
5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione has a molecular weight of 279.30 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-3,5-diphenyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 168864617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).