About 2-hydroxyacetamide;hydrate
2-hydroxyacetamide;hydrate (PubChem CID 168864854) has the molecular formula C2H7NO3
and a molecular weight of 93.08 g/mol. Its IUPAC name is 2-hydroxyacetamide;hydrate.
Molecular Properties
| Compound Name | 2-hydroxyacetamide;hydrate |
| PubChem CID | 168864854 |
| Molecular Formula | C2H7NO3 |
| Molecular Weight | 93.08 g/mol |
| Exact Mass | 93.04 |
| IUPAC Name | 2-hydroxyacetamide;hydrate |
| SMILES | NC(=O)CO.O |
| InChI | InChI=1S/C2H5NO2.H2O/c3-2(5)1-4;/h4H,1H2,(H2,3,5);1H2 |
| InChIKey | RPUISMHTXWCUHO-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.08 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxyacetamide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyacetamide;hydrate?
The IUPAC name of 2-hydroxyacetamide;hydrate (CID 168864854) is 2-hydroxyacetamide;hydrate.
What is the SMILES notation for 2-hydroxyacetamide;hydrate?
The canonical SMILES for 2-hydroxyacetamide;hydrate is NC(=O)CO.O.
What is the InChIKey of 2-hydroxyacetamide;hydrate?
The InChIKey is RPUISMHTXWCUHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.H2O/c3-2(5)1-4;/h4H,1H2,(H2,3,5);1H2.
What are the key properties of 2-hydroxyacetamide;hydrate?
2-hydroxyacetamide;hydrate has a molecular weight of 93.08 g/mol, XLogP of -2.36, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyacetamide;hydrate is sourced from PubChem (CID 168864854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).