About 4-bromo-N,N-didecylbutanamide
4-bromo-N,N-didecylbutanamide (PubChem CID 168865726) has the molecular formula C24H48BrNO
and a molecular weight of 446.56 g/mol. Its IUPAC name is 4-bromo-N,N-didecylbutanamide.
Molecular Properties
| Compound Name | 4-bromo-N,N-didecylbutanamide |
| PubChem CID | 168865726 |
| Molecular Formula | C24H48BrNO |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 4-bromo-N,N-didecylbutanamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCCBr |
| InChI | InChI=1S/C24H48BrNO/c1-3-5-7-9-11-13-15-17-22-26(24(27)20-19-21-25)23-18-16-14-12-10-8-6-4-2/h3-23H2,1-2H3 |
| InChIKey | DJUDDQBTCHFQHJ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N,N-didecylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-didecylbutanamide?
The IUPAC name of 4-bromo-N,N-didecylbutanamide (CID 168865726) is 4-bromo-N,N-didecylbutanamide.
What is the SMILES notation for 4-bromo-N,N-didecylbutanamide?
The canonical SMILES for 4-bromo-N,N-didecylbutanamide is CCCCCCCCCCN(CCCCCCCCCC)C(=O)CCCBr.
What is the InChIKey of 4-bromo-N,N-didecylbutanamide?
The InChIKey is DJUDDQBTCHFQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48BrNO/c1-3-5-7-9-11-13-15-17-22-26(24(27)20-19-21-25)23-18-16-14-12-10-8-6-4-2/h3-23H2,1-2H3.
What are the key properties of 4-bromo-N,N-didecylbutanamide?
4-bromo-N,N-didecylbutanamide has a molecular weight of 446.56 g/mol, XLogP of 8.27, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-didecylbutanamide is sourced from PubChem (CID 168865726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).