About 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one
1,2-dimethylindeno[1,2-b][1]benzothiol-10-one (PubChem CID 168866784) has the molecular formula C17H12OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one.
Molecular Properties
| Compound Name | 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one |
| PubChem CID | 168866784 |
| Molecular Formula | C17H12OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one |
| SMILES | Cc1ccc2c(c1C)C(=O)c1c-2sc2ccccc12 |
| InChI | InChI=1S/C17H12OS/c1-9-7-8-12-14(10(9)2)16(18)15-11-5-3-4-6-13(11)19-17(12)15/h3-8H,1-2H3 |
| InChIKey | PUBLHYUCZKJZFK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one?
The IUPAC name of 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one (CID 168866784) is 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one.
What is the SMILES notation for 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one?
The canonical SMILES for 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one is Cc1ccc2c(c1C)C(=O)c1c-2sc2ccccc12.
What is the InChIKey of 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one?
The InChIKey is PUBLHYUCZKJZFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12OS/c1-9-7-8-12-14(10(9)2)16(18)15-11-5-3-4-6-13(11)19-17(12)15/h3-8H,1-2H3.
What are the key properties of 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one?
1,2-dimethylindeno[1,2-b][1]benzothiol-10-one has a molecular weight of 264.35 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylindeno[1,2-b][1]benzothiol-10-one is sourced from PubChem (CID 168866784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).