About methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate
methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate (PubChem CID 168867328) has the molecular formula C11H9F4N5O2
and a molecular weight of 319.22 g/mol. Its IUPAC name is methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate |
| PubChem CID | 168867328 |
| Molecular Formula | C11H9F4N5O2 |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2cnc(NCC(F)(F)F)c(F)c2)nn1 |
| InChI | InChI=1S/C11H9F4N5O2/c1-22-10(21)8-4-20(19-18-8)6-2-7(12)9(16-3-6)17-5-11(13,14)15/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | NZMLFBQGDRXMPG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate (CID 168867328) is methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate is COC(=O)c1cn(-c2cnc(NCC(F)(F)F)c(F)c2)nn1.
What is the InChIKey of methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate?
The InChIKey is NZMLFBQGDRXMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F4N5O2/c1-22-10(21)8-4-20(19-18-8)6-2-7(12)9(16-3-6)17-5-11(13,14)15/h2-4H,5H2,1H3,(H,16,17).
What are the key properties of methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate?
methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate has a molecular weight of 319.22 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[5-fluoro-6-(2,2,2-trifluoroethylamino)-3-pyridinyl]triazole-4-carboxylate is sourced from PubChem (CID 168867328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).